C17H14ClFN4O5S — CID 87973413
1-[[3-(3-chloro-4-fluorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methyl]-1-hydroxyurea (PubChem CID 87973413) has the molecular formula C17H14ClFN4O5S and a molecular weight of 440.84 g/mol. Its IUPAC name is 1-[[3-(3-chloro-4-fluorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[3-(3-chloro-4-fluorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 87973413 |
| Molecular Formula | C17H14ClFN4O5S |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 1-[[3-(3-chloro-4-fluorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)Cc1onc(-c2ccc(F)c(Cl)c2)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H14ClFN4O5S/c18-12-7-10(3-6-13(12)19)16-15(14(28-22-16)8-23(25)17(20)24)9-1-4-11(5-2-9)29(21,26)27/h1-7,25H,8H2,(H2,20,24)(H2,21,26,27) |
| InChIKey | PYIQNZYDILQDAV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 152.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|