C15H11FN2O3S — CID 10171927
4-(5-(18F)fluoro-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 10171927) has the molecular formula C15H11FN2O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 4-(5-(18F)fluoro-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | 4-(5-(18F)fluoro-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10171927 |
| Molecular Formula | C15H11FN2O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-(5-(18F)fluoro-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2[18F])cc1 |
| InChI | InChI=1S/C15H11FN2O3S/c16-15-13(10-6-8-12(9-7-10)22(17,19)20)14(18-21-15)11-4-2-1-3-5-11/h1-9H,(H2,17,19,20)/i16-1 |
| InChIKey | RXNDRRNFYPOMKF-GKTGUEEDSA-N |
| XLogP | 2.80 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |