C17H15NO4S — CID 91810729
methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate (PubChem CID 91810729) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate.
| Compound Name | methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate |
|---|---|
| PubChem CID | 91810729 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1 |
| InChI | InChI=1S/C17H15NO4S/c1-12-16(17(18-22-12)14-6-4-3-5-7-14)13-8-10-15(11-9-13)23(19,20)21-2/h3-11H,1-2H3 |
| InChIKey | FJBTWIKYLHQUQT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|