methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate

C17H15NO4S — CID 91810729

IUPACmethyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate
SMILESCOS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1
InChIInChI=1S/C17H15NO4S/c1-12-16(17(18-22-12)14-6-4-3-5-7-14)13-8-10-15(11-9-13)23(19,20)21-2/h3-11H,1-2H3
InChIKeyFJBTWIKYLHQUQT-UHFFFAOYSA-N
MW329.38 g/mol
LogP3.65
Rot. Bonds4

About methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate

methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate (PubChem CID 91810729) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate.

Molecular Properties

Compound Namemethyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate
PubChem CID91810729
Molecular FormulaC17H15NO4S
Molecular Weight329.38 g/mol
Exact Mass329.07
IUPAC Namemethyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate
SMILESCOS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1
InChIInChI=1S/C17H15NO4S/c1-12-16(17(18-22-12)14-6-4-3-5-7-14)13-8-10-15(11-9-13)23(19,20)21-2/h3-11H,1-2H3
InChIKeyFJBTWIKYLHQUQT-UHFFFAOYSA-N
XLogP3.65
TPSA69.40 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.38
LogP ≤ 53.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate?
The IUPAC name of methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate (CID 91810729) is methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate.
What is the SMILES notation for methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate?
The canonical SMILES for methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate is COS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1.
What is the InChIKey of methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate?
The InChIKey is FJBTWIKYLHQUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4S/c1-12-16(17(18-22-12)14-6-4-3-5-7-14)13-8-10-15(11-9-13)23(19,20)21-2/h3-11H,1-2H3.
What are the key properties of methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate?
methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate has a molecular weight of 329.38 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate is sourced from PubChem (CID 91810729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).