C19H20N2O3S — CID 69083499
4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-propylbenzenesulfonamide (PubChem CID 69083499) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-propylbenzenesulfonamide.
| Compound Name | 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 69083499 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-3-13-20-25(22,23)17-11-9-15(10-12-17)18-14(2)24-21-19(18)16-7-5-4-6-8-16/h4-12,20H,3,13H2,1-2H3 |
| InChIKey | KNPMDJRAJVMBCG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |