C24H30N2O5S — CID 169084357
N-(1,1-dimethoxyhexan-2-yl)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 169084357) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is N-(1,1-dimethoxyhexan-2-yl)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | N-(1,1-dimethoxyhexan-2-yl)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 169084357 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-(1,1-dimethoxyhexan-2-yl)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | CCCCC(NS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1)C(OC)OC |
| InChI | InChI=1S/C24H30N2O5S/c1-5-6-12-21(24(29-3)30-4)26-32(27,28)20-15-13-18(14-16-20)22-17(2)31-25-23(22)19-10-8-7-9-11-19/h7-11,13-16,21,24,26H,5-6,12H2,1-4H3 |
| InChIKey | SUKCDZRTWPWQBL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|