C24H28N2O5S — CID 163249478
methyl 8-[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]octanoate (PubChem CID 163249478) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is methyl 8-[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]octanoate.
| Compound Name | methyl 8-[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]octanoate |
|---|---|
| PubChem CID | 163249478 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | methyl 8-[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]octanoate |
| SMILES | COC(=O)CCCCCCCc1onc(-c2ccccc2)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H28N2O5S/c1-30-22(27)13-9-4-2-3-8-12-21-23(18-14-16-20(17-15-18)32(25,28)29)24(26-31-21)19-10-6-5-7-11-19/h5-7,10-11,14-17H,2-4,8-9,12-13H2,1H3,(H2,25,28,29) |
| InChIKey | MPTBXHHADZDRER-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|