C18H14Cl2N2O5S — CID 67595102
3-[3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]propanoic acid (PubChem CID 67595102) has the molecular formula C18H14Cl2N2O5S and a molecular weight of 441.29 g/mol. Its IUPAC name is 3-[3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]propanoic acid.
| Compound Name | 3-[3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 67595102 |
| Molecular Formula | C18H14Cl2N2O5S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 3-[3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]propanoic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2c(-c3ccc(Cl)c(Cl)c3)noc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O5S/c19-13-6-3-11(9-14(13)20)18-17(15(27-22-18)7-8-16(23)24)10-1-4-12(5-2-10)28(21,25)26/h1-6,9H,7-8H2,(H,23,24)(H2,21,25,26) |
| InChIKey | VFJJFIRIGGXSBD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |