C19H17Cl2N3O5S — CID 87973487
4-[3-(3,4-dichlorophenyl)-4-(2-sulfamoylphenyl)-1,2-oxazol-5-yl]-N-hydroxybutanamide (PubChem CID 87973487) has the molecular formula C19H17Cl2N3O5S and a molecular weight of 470.33 g/mol. Its IUPAC name is 4-[3-(3,4-dichlorophenyl)-4-(2-sulfamoylphenyl)-1,2-oxazol-5-yl]-N-hydroxybutanamide.
| Compound Name | 4-[3-(3,4-dichlorophenyl)-4-(2-sulfamoylphenyl)-1,2-oxazol-5-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 87973487 |
| Molecular Formula | C19H17Cl2N3O5S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 4-[3-(3,4-dichlorophenyl)-4-(2-sulfamoylphenyl)-1,2-oxazol-5-yl]-N-hydroxybutanamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1c(-c2ccc(Cl)c(Cl)c2)noc1CCCC(=O)NO |
| InChI | InChI=1S/C19H17Cl2N3O5S/c20-13-9-8-11(10-14(13)21)19-18(12-4-1-2-6-16(12)30(22,27)28)15(29-24-19)5-3-7-17(25)23-26/h1-2,4,6,8-10,26H,3,5,7H2,(H,23,25)(H2,22,27,28) |
| InChIKey | JMFQYIUSTBYUCE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|