C18H16N2O6S — CID 67695410
2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methoxy]acetic acid (PubChem CID 67695410) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methoxy]acetic acid.
| Compound Name | 2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 67695410 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]methoxy]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2COCC(=O)O)cc1 |
| InChI | InChI=1S/C18H16N2O6S/c19-27(23,24)14-8-6-12(7-9-14)17-15(10-25-11-16(21)22)26-20-18(17)13-4-2-1-3-5-13/h1-9H,10-11H2,(H,21,22)(H2,19,23,24) |
| InChIKey | TUYBDDJAXMAMIZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |