C18H16N2O7S — CID 152771184
2-hydroxy-2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]oxy]propanoic acid (PubChem CID 152771184) has the molecular formula C18H16N2O7S and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-hydroxy-2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]oxy]propanoic acid.
| Compound Name | 2-hydroxy-2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 152771184 |
| Molecular Formula | C18H16N2O7S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-hydroxy-2-[[3-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl]oxy]propanoic acid |
| SMILES | CC(O)(Oc1onc(-c2ccccc2)c1-c1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C18H16N2O7S/c1-18(23,17(21)22)26-16-14(11-7-9-13(10-8-11)28(19,24)25)15(20-27-16)12-5-3-2-4-6-12/h2-10,23H,1H3,(H,21,22)(H2,19,24,25) |
| InChIKey | JSPCQLOCQGXTPA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|