C21H22N2O5S — CID 175234647
[5-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-3-yl] hexanoate (PubChem CID 175234647) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is [5-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-3-yl] hexanoate.
| Compound Name | [5-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-3-yl] hexanoate |
|---|---|
| PubChem CID | 175234647 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [5-phenyl-4-(4-sulfamoylphenyl)-1,2-oxazol-3-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1noc(-c2ccccc2)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H22N2O5S/c1-2-3-5-10-18(24)27-21-19(15-11-13-17(14-12-15)29(22,25)26)20(28-23-21)16-8-6-4-7-9-16/h4,6-9,11-14H,2-3,5,10H2,1H3,(H2,22,25,26) |
| InChIKey | NQRZTIUNWCQTTO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|