C21H22FN3O5S3 — CID 22505481
[4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl] N-butyl-N-hydroxycarbamodithioate (PubChem CID 22505481) has the molecular formula C21H22FN3O5S3 and a molecular weight of 511.62 g/mol. Its IUPAC name is [4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl] N-butyl-N-hydroxycarbamodithioate.
| Compound Name | [4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl] N-butyl-N-hydroxycarbamodithioate |
|---|---|
| PubChem CID | 22505481 |
| Molecular Formula | C21H22FN3O5S3 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | [4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl] N-butyl-N-hydroxycarbamodithioate |
| SMILES | CCCCN(O)C(=S)Sc1nc(-c2ccc(OC)c(F)c2)c(-c2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C21H22FN3O5S3/c1-3-4-11-25(26)21(31)32-20-24-18(14-7-10-17(29-2)16(22)12-14)19(30-20)13-5-8-15(9-6-13)33(23,27)28/h5-10,12,26H,3-4,11H2,1-2H3,(H2,23,27,28) |
| InChIKey | RKWGWSTYFZOXMR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|