C21H21FN2O5S2 — CID 87973585
4-[3-(3-fluoro-4-methoxyphenyl)-4-(4-sulfamoylphenyl)thiophen-2-yl]-N-hydroxybutanamide (PubChem CID 87973585) has the molecular formula C21H21FN2O5S2 and a molecular weight of 464.54 g/mol. Its IUPAC name is 4-[3-(3-fluoro-4-methoxyphenyl)-4-(4-sulfamoylphenyl)thiophen-2-yl]-N-hydroxybutanamide.
| Compound Name | 4-[3-(3-fluoro-4-methoxyphenyl)-4-(4-sulfamoylphenyl)thiophen-2-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 87973585 |
| Molecular Formula | C21H21FN2O5S2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 4-[3-(3-fluoro-4-methoxyphenyl)-4-(4-sulfamoylphenyl)thiophen-2-yl]-N-hydroxybutanamide |
| SMILES | COc1ccc(-c2c(-c3ccc(S(N)(=O)=O)cc3)csc2CCCC(=O)NO)cc1F |
| InChI | InChI=1S/C21H21FN2O5S2/c1-29-18-10-7-14(11-17(18)22)21-16(12-30-19(21)3-2-4-20(25)24-26)13-5-8-15(9-6-13)31(23,27)28/h5-12,26H,2-4H2,1H3,(H,24,25)(H2,23,27,28) |
| InChIKey | FIHJCSQTRRPMKE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|