C21H18ClN5O2 — CID 9358676
2-(4-chlorophenoxy)-N-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]acetamide (PubChem CID 9358676) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 9358676 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]acetamide |
| SMILES | N#CCCn1cc(/C=N\NC(=O)COc2ccc(Cl)cc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H18ClN5O2/c22-18-7-9-19(10-8-18)29-15-20(28)25-24-13-17-14-27(12-4-11-23)26-21(17)16-5-2-1-3-6-16/h1-3,5-10,13-14H,4,12,15H2,(H,25,28)/b24-13- |
| InChIKey | VAFFVPIZSGTNRR-CFRMEGHHSA-N |
| XLogP | 3.65 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|