C24H25N5O2 — CID 9352759
N-cyclopropyl-N'-[(Z)-[3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]oxamide (PubChem CID 9352759) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-[3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-[3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 9352759 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-[3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]oxamide |
| SMILES | Cc1ccc(Cn2cc(/C=N\NC(=O)C(=O)NC3CC3)c(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-16-3-7-18(8-4-16)14-29-15-20(22(28-29)19-9-5-17(2)6-10-19)13-25-27-24(31)23(30)26-21-11-12-21/h3-10,13,15,21H,11-12,14H2,1-2H3,(H,26,30)(H,27,31)/b25-13- |
| InChIKey | ZLQPFAULFLWAFD-MXAYSNPKSA-N |
| XLogP | 2.94 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|