C23H25N5O2 — CID 9351858
N'-[(Z)-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 9351858) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is N'-[(Z)-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 9351858 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N'-[(Z)-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | Cc1ccc(-c2nn(Cc3ccccc3)cc2/C=N\NC(=O)C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-16(2)25-22(29)23(30)26-24-13-20-15-28(14-18-7-5-4-6-8-18)27-21(20)19-11-9-17(3)10-12-19/h4-13,15-16H,14H2,1-3H3,(H,25,29)(H,26,30)/b24-13- |
| InChIKey | ZIVRPZDRUUXOER-CFRMEGHHSA-N |
| XLogP | 2.88 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|