C23H20N4O3 — CID 9231529
N-[(Z)-[1-benzyl-3-(4-methoxyphenyl)pyrazol-4-yl]methylideneamino]furan-2-carboxamide (PubChem CID 9231529) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[(Z)-[1-benzyl-3-(4-methoxyphenyl)pyrazol-4-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(Z)-[1-benzyl-3-(4-methoxyphenyl)pyrazol-4-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 9231529 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[(Z)-[1-benzyl-3-(4-methoxyphenyl)pyrazol-4-yl]methylideneamino]furan-2-carboxamide |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)cc2/C=N\NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H20N4O3/c1-29-20-11-9-18(10-12-20)22-19(14-24-25-23(28)21-8-5-13-30-21)16-27(26-22)15-17-6-3-2-4-7-17/h2-14,16H,15H2,1H3,(H,25,28)/b24-14- |
| InChIKey | PIENJTMSYIGLDL-OYKKKHCWSA-N |
| XLogP | 3.96 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|