C27H29N7O2 — CID 98909549
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide (PubChem CID 98909549) has the molecular formula C27H29N7O2 and a molecular weight of 483.58 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 98909549 |
| Molecular Formula | C27H29N7O2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1cccnc1)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C27H29N7O2/c35-25(29-15-7-17-34-27(36)33-16-5-4-11-24(33)30-34)13-12-23-20-32(19-21-8-2-1-3-9-21)31-26(23)22-10-6-14-28-18-22/h1-3,6,8-10,12-14,18,20H,4-5,7,11,15-17,19H2,(H,29,35)/b13-12+ |
| InChIKey | DCSYXENBCVTBEY-OUKQBFOZSA-N |
| XLogP | 2.91 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|