C23H16N4O2S — CID 9072543
2-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]isoindole-1,3-dione (PubChem CID 9072543) has the molecular formula C23H16N4O2S and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9072543 |
| Molecular Formula | C23H16N4O2S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1/N=C\c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C23H16N4O2S/c28-22-18-9-4-5-10-19(18)23(29)27(22)24-13-17-15-26(14-16-7-2-1-3-8-16)25-21(17)20-11-6-12-30-20/h1-13,15H,14H2/b24-13- |
| InChIKey | LCKCLCVJICZNNZ-CFRMEGHHSA-N |
| XLogP | 4.29 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|