C20H23N5S — CID 9058693
(Z)-1-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-(4-methylpiperazin-1-yl)methanimine (PubChem CID 9058693) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is (Z)-1-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-(4-methylpiperazin-1-yl)methanimine.
| Compound Name | (Z)-1-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-(4-methylpiperazin-1-yl)methanimine |
|---|---|
| PubChem CID | 9058693 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (Z)-1-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-(4-methylpiperazin-1-yl)methanimine |
| SMILES | CN1CCN(/N=C\c2cn(Cc3ccccc3)nc2-c2cccs2)CC1 |
| InChI | InChI=1S/C20H23N5S/c1-23-9-11-24(12-10-23)21-14-18-16-25(15-17-6-3-2-4-7-17)22-20(18)19-8-5-13-26-19/h2-8,13-14,16H,9-12,15H2,1H3/b21-14- |
| InChIKey | WQPZINDWKOWIOT-STZFKDTASA-N |
| XLogP | 3.24 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|