C17H10F3NOS2 — CID 72686256
3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 72686256) has the molecular formula C17H10F3NOS2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72686256 |
| Molecular Formula | C17H10F3NOS2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1csc(-c2cccs2)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F3NOS2/c18-17(19,20)12-4-1-3-11(9-12)14(22)7-6-13-10-24-16(21-13)15-5-2-8-23-15/h1-10H |
| InChIKey | NNBNYDJAABFYOH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|