C16H11F3N2O2S2 — CID 47077526
N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methoxy]-3-(trifluoromethyl)benzamide (PubChem CID 47077526) has the molecular formula C16H11F3N2O2S2 and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methoxy]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methoxy]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 47077526 |
| Molecular Formula | C16H11F3N2O2S2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methoxy]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NOCc1csc(-c2cccs2)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F3N2O2S2/c17-16(18,19)11-4-1-3-10(7-11)14(22)21-23-8-12-9-25-15(20-12)13-5-2-6-24-13/h1-7,9H,8H2,(H,21,22) |
| InChIKey | IACDFTUAUPZYMJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|