C15H10Cl2F3NO2 — CID 55856487
N-[(2,6-dichlorophenyl)methoxy]-3-(trifluoromethyl)benzamide (PubChem CID 55856487) has the molecular formula C15H10Cl2F3NO2 and a molecular weight of 364.15 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methoxy]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(2,6-dichlorophenyl)methoxy]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55856487 |
| Molecular Formula | C15H10Cl2F3NO2 |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methoxy]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NOCc1c(Cl)cccc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10Cl2F3NO2/c16-12-5-2-6-13(17)11(12)8-23-21-14(22)9-3-1-4-10(7-9)15(18,19)20/h1-7H,8H2,(H,21,22) |
| InChIKey | UAGHIXHZIKUYRR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|