C20H22N4O4S3 — CID 25494413
N,N-diethyl-3-[[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 25494413) has the molecular formula C20H22N4O4S3 and a molecular weight of 478.62 g/mol. Its IUPAC name is N,N-diethyl-3-[[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25494413 |
| Molecular Formula | C20H22N4O4S3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N,N-diethyl-3-[[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)Cc2csc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C20H22N4O4S3/c1-3-24(4-2)31(27,28)16-8-5-7-14(11-16)19(26)23-22-18(25)12-15-13-30-20(21-15)17-9-6-10-29-17/h5-11,13H,3-4,12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | IEMZAKPMDCBDQM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|