C19H24N4O5S2 — CID 30452714
N-[3-[2-[3-(diethylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 30452714) has the molecular formula C19H24N4O5S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[3-[2-[3-(diethylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[2-[3-(diethylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30452714 |
| Molecular Formula | C19H24N4O5S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[3-[2-[3-(diethylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)CCNC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C19H24N4O5S2/c1-3-23(4-2)30(27,28)16-7-5-6-14(12-16)19(26)22-21-17(24)8-10-20-18(25)15-9-11-29-13-15/h5-7,9,11-13H,3-4,8,10H2,1-2H3,(H,20,25)(H,21,24)(H,22,26) |
| InChIKey | KHSJNPZWTJNZOZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|