C17H20N4O3S — CID 27607144
N-[3-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 27607144) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[3-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 27607144 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[3-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)CCNC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C17H20N4O3S/c1-21(2)14-5-3-4-12(10-14)17(24)20-19-15(22)6-8-18-16(23)13-7-9-25-11-13/h3-5,7,9-11H,6,8H2,1-2H3,(H,18,23)(H,19,22)(H,20,24) |
| InChIKey | RHARAPHEBMFIHX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|