C16H20N2O2S — CID 99981051
3-(dimethylamino)-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]benzamide (PubChem CID 99981051) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]benzamide |
|---|---|
| PubChem CID | 99981051 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-(dimethylamino)-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]benzamide |
| SMILES | CN(C)c1cccc(C(=O)NCC[C@@H](O)c2ccsc2)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-18(2)14-5-3-4-12(10-14)16(20)17-8-6-15(19)13-7-9-21-11-13/h3-5,7,9-11,15,19H,6,8H2,1-2H3,(H,17,20)/t15-/m1/s1 |
| InChIKey | HEYCYSUSWNBRPQ-OAHLLOKOSA-N |
| XLogP | 2.67 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |