C20H21N3O2S3 — CID 24514859
N'-[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide (PubChem CID 24514859) has the molecular formula C20H21N3O2S3 and a molecular weight of 431.61 g/mol. Its IUPAC name is N'-[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 24514859 |
| Molecular Formula | C20H21N3O2S3 |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N'-[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)NNC(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C20H21N3O2S3/c24-18(11-14-12-27-20(21-14)16-8-5-9-26-16)22-23-19(25)17-10-13-6-3-1-2-4-7-15(13)28-17/h5,8-10,12H,1-4,6-7,11H2,(H,22,24)(H,23,25) |
| InChIKey | CGVQQPLGMGJDQR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|