C15H12N2S — CID 18182490
4-benzyl-2-pyridin-2-yl-1,3-thiazole (PubChem CID 18182490) has the molecular formula C15H12N2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 4-benzyl-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 4-benzyl-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 18182490 |
| Molecular Formula | C15H12N2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-benzyl-2-pyridin-2-yl-1,3-thiazole |
| SMILES | c1ccc(Cc2csc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C15H12N2S/c1-2-6-12(7-3-1)10-13-11-18-15(17-13)14-8-4-5-9-16-14/h1-9,11H,10H2 |
| InChIKey | RMTGLYPRXWVQIL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |