About 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole
4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole (PubChem CID 122140520) has the molecular formula C14H18N2O2S2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole |
| PubChem CID | 122140520 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole |
| SMILES | CC(C)(C)CS(=O)(=O)Cc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-14(2,3)10-20(17,18)9-11-8-19-13(16-11)12-6-4-5-7-15-12/h4-8H,9-10H2,1-3H3 |
| InChIKey | DWALIPHYNBWDCS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole?
The IUPAC name of 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole (CID 122140520) is 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole.
What is the SMILES notation for 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole?
The canonical SMILES for 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole is CC(C)(C)CS(=O)(=O)Cc1csc(-c2ccccn2)n1.
What is the InChIKey of 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole?
The InChIKey is DWALIPHYNBWDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S2/c1-14(2,3)10-20(17,18)9-11-8-19-13(16-11)12-6-4-5-7-15-12/h4-8H,9-10H2,1-3H3.
What are the key properties of 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole?
4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole has a molecular weight of 310.44 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole is sourced from PubChem (CID 122140520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).