C14H18N2O2S2 — CID 122140520
4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole (PubChem CID 122140520) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 122140520 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-(2,2-dimethylpropylsulfonylmethyl)-2-pyridin-2-yl-1,3-thiazole |
| SMILES | CC(C)(C)CS(=O)(=O)Cc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-14(2,3)10-20(17,18)9-11-8-19-13(16-11)12-6-4-5-7-15-12/h4-8H,9-10H2,1-3H3 |
| InChIKey | DWALIPHYNBWDCS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |