C14H10Cl2N2O — CID 114281167
5-(2-chloroethyl)-3-(5-chloroquinolin-8-yl)-1,2-oxazole (PubChem CID 114281167) has the molecular formula C14H10Cl2N2O and a molecular weight of 293.15 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-(5-chloroquinolin-8-yl)-1,2-oxazole.
| Compound Name | 5-(2-chloroethyl)-3-(5-chloroquinolin-8-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 114281167 |
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 5-(2-chloroethyl)-3-(5-chloroquinolin-8-yl)-1,2-oxazole |
| SMILES | ClCCc1cc(-c2ccc(Cl)c3cccnc23)no1 |
| InChI | InChI=1S/C14H10Cl2N2O/c15-6-5-9-8-13(18-19-9)11-3-4-12(16)10-2-1-7-17-14(10)11/h1-4,7-8H,5-6H2 |
| InChIKey | SWKBEXWVSIUTCX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|