C11H7Cl4NO2 — CID 21394179
carbonyl dichloride;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole (PubChem CID 21394179) has the molecular formula C11H7Cl4NO2 and a molecular weight of 326.99 g/mol. Its IUPAC name is carbonyl dichloride;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole.
| Compound Name | carbonyl dichloride;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 21394179 |
| Molecular Formula | C11H7Cl4NO2 |
| Molecular Weight | 326.99 g/mol |
| Exact Mass | 324.92 |
| IUPAC Name | carbonyl dichloride;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2c(Cl)cccc2Cl)no1.O=C(Cl)Cl |
| InChI | InChI=1S/C10H7Cl2NO.CCl2O/c1-6-5-9(13-14-6)10-7(11)3-2-4-8(10)12;2-1(3)4/h2-5H,1H3; |
| InChIKey | CRQPRMXXURKKSW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.99 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|