C11H7ClFNO2 — CID 14814686
1-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]ethanone (PubChem CID 14814686) has the molecular formula C11H7ClFNO2 and a molecular weight of 239.63 g/mol. Its IUPAC name is 1-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]ethanone.
| Compound Name | 1-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 14814686 |
| Molecular Formula | C11H7ClFNO2 |
| Molecular Weight | 239.63 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 1-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2c(F)cccc2Cl)no1 |
| InChI | InChI=1S/C11H7ClFNO2/c1-6(15)10-5-9(14-16-10)11-7(12)3-2-4-8(11)13/h2-5H,1H3 |
| InChIKey | ZTLILTJZQBBRJE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |