C17H11Cl2FN2O2 — CID 174462735
2-chloro-N-[3-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]phenyl]acetamide (PubChem CID 174462735) has the molecular formula C17H11Cl2FN2O2 and a molecular weight of 365.19 g/mol. Its IUPAC name is 2-chloro-N-[3-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 174462735 |
| Molecular Formula | C17H11Cl2FN2O2 |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-chloro-N-[3-[3-(2-chloro-6-fluorophenyl)-1,2-oxazol-5-yl]phenyl]acetamide |
| SMILES | O=C(CCl)Nc1cccc(-c2cc(-c3c(F)cccc3Cl)no2)c1 |
| InChI | InChI=1S/C17H11Cl2FN2O2/c18-9-16(23)21-11-4-1-3-10(7-11)15-8-14(22-24-15)17-12(19)5-2-6-13(17)20/h1-8H,9H2,(H,21,23) |
| InChIKey | UVSPVPULZGQHDU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|