C17H10Cl4N2O2 — CID 3007230
2,2-dichloro-N-[3-[5-(2,6-dichlorophenyl)-1,2-oxazol-3-yl]phenyl]acetamide (PubChem CID 3007230) has the molecular formula C17H10Cl4N2O2 and a molecular weight of 416.09 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[5-(2,6-dichlorophenyl)-1,2-oxazol-3-yl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[5-(2,6-dichlorophenyl)-1,2-oxazol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3007230 |
| Molecular Formula | C17H10Cl4N2O2 |
| Molecular Weight | 416.09 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2,2-dichloro-N-[3-[5-(2,6-dichlorophenyl)-1,2-oxazol-3-yl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc(-c2cc(-c3c(Cl)cccc3Cl)on2)c1)C(Cl)Cl |
| InChI | InChI=1S/C17H10Cl4N2O2/c18-11-5-2-6-12(19)15(11)14-8-13(23-25-14)9-3-1-4-10(7-9)22-17(24)16(20)21/h1-8,16H,(H,22,24) |
| InChIKey | JHVNVXFBEIBOGQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.09 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|