C22H21Cl2N3O3 — CID 10138515
2,2-dichloro-N-[3-[3-[2-(morpholin-4-ylmethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide (PubChem CID 10138515) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[3-[2-(morpholin-4-ylmethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[3-[2-(morpholin-4-ylmethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 10138515 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2,2-dichloro-N-[3-[3-[2-(morpholin-4-ylmethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc(-c2cc(-c3ccccc3CN3CCOCC3)no2)c1)C(Cl)Cl |
| InChI | InChI=1S/C22H21Cl2N3O3/c23-21(24)22(28)25-17-6-3-5-15(12-17)20-13-19(26-30-20)18-7-2-1-4-16(18)14-27-8-10-29-11-9-27/h1-7,12-13,21H,8-11,14H2,(H,25,28) |
| InChIKey | CCGWRLYYUKLPBL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|