C19H15Cl2N3O4 — CID 10432235
ethyl 2-[5-[3-[(2,2-dichloroacetyl)amino]phenyl]-1,2-oxazol-3-yl]pyridine-3-carboxylate (PubChem CID 10432235) has the molecular formula C19H15Cl2N3O4 and a molecular weight of 420.25 g/mol. Its IUPAC name is ethyl 2-[5-[3-[(2,2-dichloroacetyl)amino]phenyl]-1,2-oxazol-3-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[5-[3-[(2,2-dichloroacetyl)amino]phenyl]-1,2-oxazol-3-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10432235 |
| Molecular Formula | C19H15Cl2N3O4 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | ethyl 2-[5-[3-[(2,2-dichloroacetyl)amino]phenyl]-1,2-oxazol-3-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1-c1cc(-c2cccc(NC(=O)C(Cl)Cl)c2)on1 |
| InChI | InChI=1S/C19H15Cl2N3O4/c1-2-27-19(26)13-7-4-8-22-16(13)14-10-15(28-24-14)11-5-3-6-12(9-11)23-18(25)17(20)21/h3-10,17H,2H2,1H3,(H,23,25) |
| InChIKey | GGSQHNUHOFONJA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|