C17H12Cl2FN3O3 — CID 10023630
2,2-dichloro-N-[5-[3-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide (PubChem CID 10023630) has the molecular formula C17H12Cl2FN3O3 and a molecular weight of 396.21 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-[3-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide.
| Compound Name | 2,2-dichloro-N-[5-[3-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 10023630 |
| Molecular Formula | C17H12Cl2FN3O3 |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | 2,2-dichloro-N-[5-[3-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide |
| SMILES | COc1cccc(F)c1-c1cc(-c2cncc(NC(=O)C(Cl)Cl)c2)on1 |
| InChI | InChI=1S/C17H12Cl2FN3O3/c1-25-13-4-2-3-11(20)15(13)12-6-14(26-23-12)9-5-10(8-21-7-9)22-17(24)16(18)19/h2-8,16H,1H3,(H,22,24) |
| InChIKey | PGTJQSSPFCPVSQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|