C18H11Cl2F3N2O3 — CID 135500133
2,2-dichloro-N-[4-[3-[2-hydroxy-6-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide (PubChem CID 135500133) has the molecular formula C18H11Cl2F3N2O3 and a molecular weight of 431.20 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-[3-[2-hydroxy-6-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[4-[3-[2-hydroxy-6-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 135500133 |
| Molecular Formula | C18H11Cl2F3N2O3 |
| Molecular Weight | 431.20 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2,2-dichloro-N-[4-[3-[2-hydroxy-6-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]phenyl]acetamide |
| SMILES | O=C(Nc1ccc(-c2cc(-c3c(O)cccc3C(F)(F)F)no2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C18H11Cl2F3N2O3/c19-16(20)17(27)24-10-6-4-9(5-7-10)14-8-12(25-28-14)15-11(18(21,22)23)2-1-3-13(15)26/h1-8,16,26H,(H,24,27) |
| InChIKey | KEGCMFHTRSUFTO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.20 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|