C18H12Cl4N2O3 — CID 3007284
2,2-dichloro-N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-methoxyphenyl]acetamide (PubChem CID 3007284) has the molecular formula C18H12Cl4N2O3 and a molecular weight of 446.12 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-methoxyphenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 3007284 |
| Molecular Formula | C18H12Cl4N2O3 |
| Molecular Weight | 446.12 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | 2,2-dichloro-N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(=O)C(Cl)Cl)cc1-c1cc(-c2c(Cl)cccc2Cl)no1 |
| InChI | InChI=1S/C18H12Cl4N2O3/c1-26-14-6-5-9(23-18(25)17(21)22)7-10(14)15-8-13(24-27-15)16-11(19)3-2-4-12(16)20/h2-8,17H,1H3,(H,23,25) |
| InChIKey | ATXVBXPHNAVXPD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.12 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|