C23H17Cl4N3O5S — CID 158697376
2,2-dichloro-N-[2-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-pyridinyl]acetamide;phenylmethanesulfonic acid (PubChem CID 158697376) has the molecular formula C23H17Cl4N3O5S and a molecular weight of 589.28 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-pyridinyl]acetamide;phenylmethanesulfonic acid.
| Compound Name | 2,2-dichloro-N-[2-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-pyridinyl]acetamide;phenylmethanesulfonic acid |
|---|---|
| PubChem CID | 158697376 |
| Molecular Formula | C23H17Cl4N3O5S |
| Molecular Weight | 589.28 g/mol |
| Exact Mass | 586.96 |
| IUPAC Name | 2,2-dichloro-N-[2-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]-4-pyridinyl]acetamide;phenylmethanesulfonic acid |
| SMILES | O=C(Nc1ccnc(-c2cc(-c3c(Cl)cccc3Cl)no2)c1)C(Cl)Cl.O=S(=O)(O)Cc1ccccc1 |
| InChI | InChI=1S/C16H9Cl4N3O2.C7H8O3S/c17-9-2-1-3-10(18)14(9)12-7-13(25-23-12)11-6-8(4-5-21-11)22-16(24)15(19)20;8-11(9,10)6-7-4-2-1-3-5-7/h1-7,15H,(H,21,22,24);1-5H,6H2,(H,8,9,10) |
| InChIKey | IHCRLUDHPKKZKH-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.28 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|