C21H18Cl3N3O2 — CID 10072482
2,2-dichloro-N-[3-[3-(2-chloro-6-cyclopentylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide (PubChem CID 10072482) has the molecular formula C21H18Cl3N3O2 and a molecular weight of 450.75 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[3-(2-chloro-6-cyclopentylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[3-(2-chloro-6-cyclopentylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 10072482 |
| Molecular Formula | C21H18Cl3N3O2 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2,2-dichloro-N-[3-[3-(2-chloro-6-cyclopentylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc(-c2nc(-c3c(Cl)cccc3C3CCCC3)no2)c1)C(Cl)Cl |
| InChI | InChI=1S/C21H18Cl3N3O2/c22-16-10-4-9-15(12-5-1-2-6-12)17(16)19-26-21(29-27-19)13-7-3-8-14(11-13)25-20(28)18(23)24/h3-4,7-12,18H,1-2,5-6H2,(H,25,28) |
| InChIKey | KAEBJEGPJARFAN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|