C19H17ClN4O2 — CID 50777666
1-(2-chlorophenyl)-3-[3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea (PubChem CID 50777666) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 50777666 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2noc(C3CCC3)n2)c1)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H17ClN4O2/c20-15-9-1-2-10-16(15)22-19(25)21-14-8-4-7-13(11-14)17-23-18(26-24-17)12-5-3-6-12/h1-2,4,7-12H,3,5-6H2,(H2,21,22,25) |
| InChIKey | MFSXIQVZTJNMLI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |