C23H24N4O2 — CID 50778293
1-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea (PubChem CID 50778293) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 50778293 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
| SMILES | O=C(Nc1ccc(-c2noc(C3CCC3)n2)cc1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C23H24N4O2/c28-23(25-20-10-4-6-15-5-1-2-9-19(15)20)24-18-13-11-16(12-14-18)21-26-22(29-27-21)17-7-3-8-17/h4,6,10-14,17H,1-3,5,7-9H2,(H2,24,25,28) |
| InChIKey | UFPYECWINQDIAO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |