C13H12N2O3 — CID 61339415
4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid (PubChem CID 61339415) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid.
| Compound Name | 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 61339415 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2noc(C3CCC3)n2)cc1 |
| InChI | InChI=1S/C13H12N2O3/c16-13(17)10-6-4-8(5-7-10)11-14-12(18-15-11)9-2-1-3-9/h4-7,9H,1-3H2,(H,16,17) |
| InChIKey | HSZFMLAJYFXFPJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |