4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid

C13H12N2O3 — CID 61339415

IUPAC4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2noc(C3CCC3)n2)cc1
InChIInChI=1S/C13H12N2O3/c16-13(17)10-6-4-8(5-7-10)11-14-12(18-15-11)9-2-1-3-9/h4-7,9H,1-3H2,(H,16,17)
InChIKeyHSZFMLAJYFXFPJ-UHFFFAOYSA-N
MW244.25 g/mol
LogP2.70
Rot. Bonds3

About 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid

4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid (PubChem CID 61339415) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid.

Molecular Properties

Compound Name4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid
PubChem CID61339415
Molecular FormulaC13H12N2O3
Molecular Weight244.25 g/mol
Exact Mass244.08
IUPAC Name4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2noc(C3CCC3)n2)cc1
InChIInChI=1S/C13H12N2O3/c16-13(17)10-6-4-8(5-7-10)11-14-12(18-15-11)9-2-1-3-9/h4-7,9H,1-3H2,(H,16,17)
InChIKeyHSZFMLAJYFXFPJ-UHFFFAOYSA-N
XLogP2.70
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.25
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid?
The IUPAC name of 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid (CID 61339415) is 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid.
What is the SMILES notation for 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid?
The canonical SMILES for 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid is O=C(O)c1ccc(-c2noc(C3CCC3)n2)cc1.
What is the InChIKey of 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid?
The InChIKey is HSZFMLAJYFXFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c16-13(17)10-6-4-8(5-7-10)11-14-12(18-15-11)9-2-1-3-9/h4-7,9H,1-3H2,(H,16,17).
What are the key properties of 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid?
4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid has a molecular weight of 244.25 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)benzoic acid is sourced from PubChem (CID 61339415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).