C14H14N2O3 — CID 53429627
ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate (PubChem CID 53429627) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate.
| Compound Name | ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate |
|---|---|
| PubChem CID | 53429627 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2noc(C3CC3)n2)cc1 |
| InChI | InChI=1S/C14H14N2O3/c1-2-18-14(17)11-7-3-9(4-8-11)12-15-13(19-16-12)10-5-6-10/h3-4,7-8,10H,2,5-6H2,1H3 |
| InChIKey | YUKRBJVOIXTABL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |