C16H21N4O6P — CID 143728097
[2-amino-3-[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)anilino]-3-oxopropyl] dihydrogen phosphate (PubChem CID 143728097) has the molecular formula C16H21N4O6P and a molecular weight of 396.34 g/mol. Its IUPAC name is [2-amino-3-[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)anilino]-3-oxopropyl] dihydrogen phosphate.
| Compound Name | [2-amino-3-[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)anilino]-3-oxopropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 143728097 |
| Molecular Formula | C16H21N4O6P |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [2-amino-3-[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)anilino]-3-oxopropyl] dihydrogen phosphate |
| SMILES | NC(COP(=O)(O)O)C(=O)Nc1ccc(-c2noc(C3CCCC3)n2)cc1 |
| InChI | InChI=1S/C16H21N4O6P/c17-13(9-25-27(22,23)24)15(21)18-12-7-5-10(6-8-12)14-19-16(26-20-14)11-3-1-2-4-11/h5-8,11,13H,1-4,9,17H2,(H,18,21)(H2,22,23,24) |
| InChIKey | XQKZTGZLLQEJEO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|