C23H26N4O4S — CID 170082956
2-[[3-[[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid (PubChem CID 170082956) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[[3-[[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid.
| Compound Name | 2-[[3-[[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid |
|---|---|
| PubChem CID | 170082956 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[[3-[[4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid |
| SMILES | O=C(Nc1ccc(-c2noc(C3CCCC3)n2)cc1)c1cccc(CNCCS(=O)O)c1 |
| InChI | InChI=1S/C23H26N4O4S/c28-22(19-7-3-4-16(14-19)15-24-12-13-32(29)30)25-20-10-8-17(9-11-20)21-26-23(31-27-21)18-5-1-2-6-18/h3-4,7-11,14,18,24H,1-2,5-6,12-13,15H2,(H,25,28)(H,29,30) |
| InChIKey | URPTXMDHUXKZDJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|