C31H28FN5O4S — CID 169121962
2-[[3-[[4-[5-[4-[(2-fluorophenoxy)methyl]phenyl]-1H-1,2,4-triazol-3-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid (PubChem CID 169121962) has the molecular formula C31H28FN5O4S and a molecular weight of 585.66 g/mol. Its IUPAC name is 2-[[3-[[4-[5-[4-[(2-fluorophenoxy)methyl]phenyl]-1H-1,2,4-triazol-3-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid.
| Compound Name | 2-[[3-[[4-[5-[4-[(2-fluorophenoxy)methyl]phenyl]-1H-1,2,4-triazol-3-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid |
|---|---|
| PubChem CID | 169121962 |
| Molecular Formula | C31H28FN5O4S |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | 2-[[3-[[4-[5-[4-[(2-fluorophenoxy)methyl]phenyl]-1H-1,2,4-triazol-3-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinic acid |
| SMILES | O=C(Nc1ccc(-c2n[nH]c(-c3ccc(COc4ccccc4F)cc3)n2)cc1)c1cccc(CNCCS(=O)O)c1 |
| InChI | InChI=1S/C31H28FN5O4S/c32-27-6-1-2-7-28(27)41-20-21-8-10-23(11-9-21)29-35-30(37-36-29)24-12-14-26(15-13-24)34-31(38)25-5-3-4-22(18-25)19-33-16-17-42(39)40/h1-15,18,33H,16-17,19-20H2,(H,34,38)(H,39,40)(H,35,36,37) |
| InChIKey | YFXVLURWYBMTDV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|