C34H34FN5O2S — CID 169122005
N-[4-[[(2Z)-2-[[4-[(2-fluorophenoxy)methyl]phenyl]-(methylideneamino)methylidene]hydrazinyl]methyl]phenyl]-3-(thiomorpholin-4-ylmethyl)benzamide (PubChem CID 169122005) has the molecular formula C34H34FN5O2S and a molecular weight of 595.74 g/mol. Its IUPAC name is N-[4-[[(2Z)-2-[[4-[(2-fluorophenoxy)methyl]phenyl]-(methylideneamino)methylidene]hydrazinyl]methyl]phenyl]-3-(thiomorpholin-4-ylmethyl)benzamide.
| Compound Name | N-[4-[[(2Z)-2-[[4-[(2-fluorophenoxy)methyl]phenyl]-(methylideneamino)methylidene]hydrazinyl]methyl]phenyl]-3-(thiomorpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 169122005 |
| Molecular Formula | C34H34FN5O2S |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | N-[4-[[(2Z)-2-[[4-[(2-fluorophenoxy)methyl]phenyl]-(methylideneamino)methylidene]hydrazinyl]methyl]phenyl]-3-(thiomorpholin-4-ylmethyl)benzamide |
| SMILES | C=N/C(=N\NCc1ccc(NC(=O)c2cccc(CN3CCSCC3)c2)cc1)c1ccc(COc2ccccc2F)cc1 |
| InChI | InChI=1S/C34H34FN5O2S/c1-36-33(28-13-9-26(10-14-28)24-42-32-8-3-2-7-31(32)35)39-37-22-25-11-15-30(16-12-25)38-34(41)29-6-4-5-27(21-29)23-40-17-19-43-20-18-40/h2-16,21,37H,1,17-20,22-24H2,(H,38,41)/b39-33- |
| InChIKey | WSFGVVTWXFWPMV-SCURRHDHSA-N |
| XLogP | 6.36 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|